About 3-(6-bromo-2-pyridinyl)-1,1-dimethylurea
3-(6-bromo-2-pyridinyl)-1,1-dimethylurea (PubChem CID 79153744) has the molecular formula C8H10BrN3O
and a molecular weight of 244.09 g/mol. Its IUPAC name is 3-(6-bromo-2-pyridinyl)-1,1-dimethylurea.
Molecular Properties
| Compound Name | 3-(6-bromo-2-pyridinyl)-1,1-dimethylurea |
| PubChem CID | 79153744 |
| Molecular Formula | C8H10BrN3O |
| Molecular Weight | 244.09 g/mol |
| Exact Mass | 243.00 |
| IUPAC Name | 3-(6-bromo-2-pyridinyl)-1,1-dimethylurea |
| SMILES | CN(C)C(=O)Nc1cccc(Br)n1 |
| InChI | InChI=1S/C8H10BrN3O/c1-12(2)8(13)11-7-5-3-4-6(9)10-7/h3-5H,1-2H3,(H,10,11,13) |
| InChIKey | AAESIBYFTLQCKI-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.09 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 3-(6-bromo-2-pyridinyl)-1,1-dimethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(6-bromo-2-pyridinyl)-1,1-dimethylurea?
The IUPAC name of 3-(6-bromo-2-pyridinyl)-1,1-dimethylurea (CID 79153744) is 3-(6-bromo-2-pyridinyl)-1,1-dimethylurea.
What is the SMILES notation for 3-(6-bromo-2-pyridinyl)-1,1-dimethylurea?
The canonical SMILES for 3-(6-bromo-2-pyridinyl)-1,1-dimethylurea is CN(C)C(=O)Nc1cccc(Br)n1.
What is the InChIKey of 3-(6-bromo-2-pyridinyl)-1,1-dimethylurea?
The InChIKey is AAESIBYFTLQCKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10BrN3O/c1-12(2)8(13)11-7-5-3-4-6(9)10-7/h3-5H,1-2H3,(H,10,11,13).
What are the key properties of 3-(6-bromo-2-pyridinyl)-1,1-dimethylurea?
3-(6-bromo-2-pyridinyl)-1,1-dimethylurea has a molecular weight of 244.09 g/mol, XLogP of 1.94, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(6-bromo-2-pyridinyl)-1,1-dimethylurea is sourced from PubChem (CID 79153744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).