About 3-(2-amino-2-iminoethyl)-1,1-dimethylurea
3-(2-amino-2-iminoethyl)-1,1-dimethylurea (PubChem CID 79153880) has the molecular formula C5H12N4O
and a molecular weight of 144.18 g/mol. Its IUPAC name is 3-(2-amino-2-iminoethyl)-1,1-dimethylurea.
Molecular Properties
| Compound Name | 3-(2-amino-2-iminoethyl)-1,1-dimethylurea |
| PubChem CID | 79153880 |
| Molecular Formula | C5H12N4O |
| Molecular Weight | 144.18 g/mol |
| Exact Mass | 144.10 |
| IUPAC Name | 3-(2-amino-2-iminoethyl)-1,1-dimethylurea |
| SMILES | [H]/N=C(\N)CNC(=O)N(C)C |
| InChI | InChI=1S/C5H12N4O/c1-9(2)5(10)8-3-4(6)7/h3H2,1-2H3,(H3,6,7)(H,8,10) |
| InChIKey | OJKCWTRCJDQXSV-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 82.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.18 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-amino-2-iminoethyl)-1,1-dimethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-amino-2-iminoethyl)-1,1-dimethylurea?
The IUPAC name of 3-(2-amino-2-iminoethyl)-1,1-dimethylurea (CID 79153880) is 3-(2-amino-2-iminoethyl)-1,1-dimethylurea.
What is the SMILES notation for 3-(2-amino-2-iminoethyl)-1,1-dimethylurea?
The canonical SMILES for 3-(2-amino-2-iminoethyl)-1,1-dimethylurea is [H]/N=C(\N)CNC(=O)N(C)C.
What is the InChIKey of 3-(2-amino-2-iminoethyl)-1,1-dimethylurea?
The InChIKey is OJKCWTRCJDQXSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N4O/c1-9(2)5(10)8-3-4(6)7/h3H2,1-2H3,(H3,6,7)(H,8,10).
What are the key properties of 3-(2-amino-2-iminoethyl)-1,1-dimethylurea?
3-(2-amino-2-iminoethyl)-1,1-dimethylurea has a molecular weight of 144.18 g/mol, XLogP of -0.81, 2 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-amino-2-iminoethyl)-1,1-dimethylurea is sourced from PubChem (CID 79153880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).