C23H26N4O4 — CID 7915396
[2-(4-carbamoylanilino)-2-oxoethyl] (E)-2-cyano-3-[2,5-dimethyl-1-(2-methylpropyl)pyrrol-3-yl]prop-2-enoate (PubChem CID 7915396) has the molecular formula C23H26N4O4 and a molecular weight of 422.49 g/mol. Its IUPAC name is [2-(4-carbamoylanilino)-2-oxoethyl] (E)-2-cyano-3-[2,5-dimethyl-1-(2-methylpropyl)pyrrol-3-yl]prop-2-enoate.
| Compound Name | [2-(4-carbamoylanilino)-2-oxoethyl] (E)-2-cyano-3-[2,5-dimethyl-1-(2-methylpropyl)pyrrol-3-yl]prop-2-enoate |
|---|---|
| PubChem CID | 7915396 |
| Molecular Formula | C23H26N4O4 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | [2-(4-carbamoylanilino)-2-oxoethyl] (E)-2-cyano-3-[2,5-dimethyl-1-(2-methylpropyl)pyrrol-3-yl]prop-2-enoate |
| SMILES | Cc1cc(/C=C(\C#N)C(=O)OCC(=O)Nc2ccc(C(N)=O)cc2)c(C)n1CC(C)C |
| InChI | InChI=1S/C23H26N4O4/c1-14(2)12-27-15(3)9-18(16(27)4)10-19(11-24)23(30)31-13-21(28)26-20-7-5-17(6-8-20)22(25)29/h5-10,14H,12-13H2,1-4H3,(H2,25,29)(H,26,28)/b19-10+ |
| InChIKey | SUWXUPFTEXLWBC-VXLYETTFSA-N |
| XLogP | 2.95 |
| TPSA | 127.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|