C9H19N3O — CID 79154067
3-[1-(aminomethyl)cyclopentyl]-1,1-dimethylurea (PubChem CID 79154067) has the molecular formula C9H19N3O and a molecular weight of 185.27 g/mol. Its IUPAC name is 3-[1-(aminomethyl)cyclopentyl]-1,1-dimethylurea.
| Compound Name | 3-[1-(aminomethyl)cyclopentyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 79154067 |
| Molecular Formula | C9H19N3O |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.15 |
| IUPAC Name | 3-[1-(aminomethyl)cyclopentyl]-1,1-dimethylurea |
| SMILES | CN(C)C(=O)NC1(CN)CCCC1 |
| InChI | InChI=1S/C9H19N3O/c1-12(2)8(13)11-9(7-10)5-3-4-6-9/h3-7,10H2,1-2H3,(H,11,13) |
| InChIKey | WMIOTQYKANAPJN-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |