About 4-hydroxyimino-N,N-dimethylpiperidine-1-carboxamide
4-hydroxyimino-N,N-dimethylpiperidine-1-carboxamide (PubChem CID 79154081) has the molecular formula C8H15N3O2
and a molecular weight of 185.23 g/mol. Its IUPAC name is 4-hydroxyimino-N,N-dimethylpiperidine-1-carboxamide.
Molecular Properties
| Compound Name | 4-hydroxyimino-N,N-dimethylpiperidine-1-carboxamide |
| PubChem CID | 79154081 |
| Molecular Formula | C8H15N3O2 |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | 4-hydroxyimino-N,N-dimethylpiperidine-1-carboxamide |
| SMILES | CN(C)C(=O)N1CCC(=NO)CC1 |
| InChI | InChI=1S/C8H15N3O2/c1-10(2)8(12)11-5-3-7(9-13)4-6-11/h13H,3-6H2,1-2H3 |
| InChIKey | SFOXQZGMGPMLEC-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 56.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-hydroxyimino-N,N-dimethylpiperidine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxyimino-N,N-dimethylpiperidine-1-carboxamide?
The IUPAC name of 4-hydroxyimino-N,N-dimethylpiperidine-1-carboxamide (CID 79154081) is 4-hydroxyimino-N,N-dimethylpiperidine-1-carboxamide.
What is the SMILES notation for 4-hydroxyimino-N,N-dimethylpiperidine-1-carboxamide?
The canonical SMILES for 4-hydroxyimino-N,N-dimethylpiperidine-1-carboxamide is CN(C)C(=O)N1CCC(=NO)CC1.
What is the InChIKey of 4-hydroxyimino-N,N-dimethylpiperidine-1-carboxamide?
The InChIKey is SFOXQZGMGPMLEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N3O2/c1-10(2)8(12)11-5-3-7(9-13)4-6-11/h13H,3-6H2,1-2H3.
What are the key properties of 4-hydroxyimino-N,N-dimethylpiperidine-1-carboxamide?
4-hydroxyimino-N,N-dimethylpiperidine-1-carboxamide has a molecular weight of 185.23 g/mol, XLogP of 0.59, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxyimino-N,N-dimethylpiperidine-1-carboxamide is sourced from PubChem (CID 79154081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).