C10H14FN3O — CID 79154504
3-[3-(aminomethyl)-4-fluorophenyl]-1,1-dimethylurea (PubChem CID 79154504) has the molecular formula C10H14FN3O and a molecular weight of 211.24 g/mol. Its IUPAC name is 3-[3-(aminomethyl)-4-fluorophenyl]-1,1-dimethylurea.
| Compound Name | 3-[3-(aminomethyl)-4-fluorophenyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 79154504 |
| Molecular Formula | C10H14FN3O |
| Molecular Weight | 211.24 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | 3-[3-(aminomethyl)-4-fluorophenyl]-1,1-dimethylurea |
| SMILES | CN(C)C(=O)Nc1ccc(F)c(CN)c1 |
| InChI | InChI=1S/C10H14FN3O/c1-14(2)10(15)13-8-3-4-9(11)7(5-8)6-12/h3-5H,6,12H2,1-2H3,(H,13,15) |
| InChIKey | DDHLQQKUAUJBQD-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.24 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |