About 1-(2-amino-2-sulfanylideneethyl)-3,3-dimethyl-1-propylurea
1-(2-amino-2-sulfanylideneethyl)-3,3-dimethyl-1-propylurea (PubChem CID 79154517) has the molecular formula C8H17N3OS
and a molecular weight of 203.31 g/mol. Its IUPAC name is 1-(2-amino-2-sulfanylideneethyl)-3,3-dimethyl-1-propylurea.
Molecular Properties
| Compound Name | 1-(2-amino-2-sulfanylideneethyl)-3,3-dimethyl-1-propylurea |
| PubChem CID | 79154517 |
| Molecular Formula | C8H17N3OS |
| Molecular Weight | 203.31 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | 1-(2-amino-2-sulfanylideneethyl)-3,3-dimethyl-1-propylurea |
| SMILES | CCCN(CC(N)=S)C(=O)N(C)C |
| InChI | InChI=1S/C8H17N3OS/c1-4-5-11(6-7(9)13)8(12)10(2)3/h4-6H2,1-3H3,(H2,9,13) |
| InChIKey | JLBOFQZVWPDOPM-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.31 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-amino-2-sulfanylideneethyl)-3,3-dimethyl-1-propylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-amino-2-sulfanylideneethyl)-3,3-dimethyl-1-propylurea?
The IUPAC name of 1-(2-amino-2-sulfanylideneethyl)-3,3-dimethyl-1-propylurea (CID 79154517) is 1-(2-amino-2-sulfanylideneethyl)-3,3-dimethyl-1-propylurea.
What is the SMILES notation for 1-(2-amino-2-sulfanylideneethyl)-3,3-dimethyl-1-propylurea?
The canonical SMILES for 1-(2-amino-2-sulfanylideneethyl)-3,3-dimethyl-1-propylurea is CCCN(CC(N)=S)C(=O)N(C)C.
What is the InChIKey of 1-(2-amino-2-sulfanylideneethyl)-3,3-dimethyl-1-propylurea?
The InChIKey is JLBOFQZVWPDOPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17N3OS/c1-4-5-11(6-7(9)13)8(12)10(2)3/h4-6H2,1-3H3,(H2,9,13).
What are the key properties of 1-(2-amino-2-sulfanylideneethyl)-3,3-dimethyl-1-propylurea?
1-(2-amino-2-sulfanylideneethyl)-3,3-dimethyl-1-propylurea has a molecular weight of 203.31 g/mol, XLogP of 0.67, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-amino-2-sulfanylideneethyl)-3,3-dimethyl-1-propylurea is sourced from PubChem (CID 79154517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).