C15H23N3O — CID 79154554
1-[(3-aminophenyl)methyl]-1-cyclopropyl-3,3-diethylurea (PubChem CID 79154554) has the molecular formula C15H23N3O and a molecular weight of 261.37 g/mol. Its IUPAC name is 1-[(3-aminophenyl)methyl]-1-cyclopropyl-3,3-diethylurea.
| Compound Name | 1-[(3-aminophenyl)methyl]-1-cyclopropyl-3,3-diethylurea |
|---|---|
| PubChem CID | 79154554 |
| Molecular Formula | C15H23N3O |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.18 |
| IUPAC Name | 1-[(3-aminophenyl)methyl]-1-cyclopropyl-3,3-diethylurea |
| SMILES | CCN(CC)C(=O)N(Cc1cccc(N)c1)C1CC1 |
| InChI | InChI=1S/C15H23N3O/c1-3-17(4-2)15(19)18(14-8-9-14)11-12-6-5-7-13(16)10-12/h5-7,10,14H,3-4,8-9,11,16H2,1-2H3 |
| InChIKey | GIUJDRYASGNOIV-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|