About 1-[[4-(4-hydroxybut-1-ynyl)thiophen-2-yl]methyl]-1,3,3-trimethylurea
1-[[4-(4-hydroxybut-1-ynyl)thiophen-2-yl]methyl]-1,3,3-trimethylurea (PubChem CID 79154642) has the molecular formula C13H18N2O2S
and a molecular weight of 266.37 g/mol. Its IUPAC name is 1-[[4-(4-hydroxybut-1-ynyl)thiophen-2-yl]methyl]-1,3,3-trimethylurea.
Molecular Properties
| Compound Name | 1-[[4-(4-hydroxybut-1-ynyl)thiophen-2-yl]methyl]-1,3,3-trimethylurea |
| PubChem CID | 79154642 |
| Molecular Formula | C13H18N2O2S |
| Molecular Weight | 266.37 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 1-[[4-(4-hydroxybut-1-ynyl)thiophen-2-yl]methyl]-1,3,3-trimethylurea |
| SMILES | CN(C)C(=O)N(C)Cc1cc(C#CCCO)cs1 |
| InChI | InChI=1S/C13H18N2O2S/c1-14(2)13(17)15(3)9-12-8-11(10-18-12)6-4-5-7-16/h8,10,16H,5,7,9H2,1-3H3 |
| InChIKey | GATDVHRKWLIFOU-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.37 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[[4-(4-hydroxybut-1-ynyl)thiophen-2-yl]methyl]-1,3,3-trimethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[4-(4-hydroxybut-1-ynyl)thiophen-2-yl]methyl]-1,3,3-trimethylurea?
The IUPAC name of 1-[[4-(4-hydroxybut-1-ynyl)thiophen-2-yl]methyl]-1,3,3-trimethylurea (CID 79154642) is 1-[[4-(4-hydroxybut-1-ynyl)thiophen-2-yl]methyl]-1,3,3-trimethylurea.
What is the SMILES notation for 1-[[4-(4-hydroxybut-1-ynyl)thiophen-2-yl]methyl]-1,3,3-trimethylurea?
The canonical SMILES for 1-[[4-(4-hydroxybut-1-ynyl)thiophen-2-yl]methyl]-1,3,3-trimethylurea is CN(C)C(=O)N(C)Cc1cc(C#CCCO)cs1.
What is the InChIKey of 1-[[4-(4-hydroxybut-1-ynyl)thiophen-2-yl]methyl]-1,3,3-trimethylurea?
The InChIKey is GATDVHRKWLIFOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2O2S/c1-14(2)13(17)15(3)9-12-8-11(10-18-12)6-4-5-7-16/h8,10,16H,5,7,9H2,1-3H3.
What are the key properties of 1-[[4-(4-hydroxybut-1-ynyl)thiophen-2-yl]methyl]-1,3,3-trimethylurea?
1-[[4-(4-hydroxybut-1-ynyl)thiophen-2-yl]methyl]-1,3,3-trimethylurea has a molecular weight of 266.37 g/mol, XLogP of 1.60, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[4-(4-hydroxybut-1-ynyl)thiophen-2-yl]methyl]-1,3,3-trimethylurea is sourced from PubChem (CID 79154642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).