C11H21N3O — CID 79154748
N,N-dimethyl-2-pyrrolidin-2-ylpyrrolidine-1-carboxamide (PubChem CID 79154748) has the molecular formula C11H21N3O and a molecular weight of 211.31 g/mol. Its IUPAC name is N,N-dimethyl-2-pyrrolidin-2-ylpyrrolidine-1-carboxamide.
| Compound Name | N,N-dimethyl-2-pyrrolidin-2-ylpyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 79154748 |
| Molecular Formula | C11H21N3O |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.17 |
| IUPAC Name | N,N-dimethyl-2-pyrrolidin-2-ylpyrrolidine-1-carboxamide |
| SMILES | CN(C)C(=O)N1CCCC1C1CCCN1 |
| InChI | InChI=1S/C11H21N3O/c1-13(2)11(15)14-8-4-6-10(14)9-5-3-7-12-9/h9-10,12H,3-8H2,1-2H3 |
| InChIKey | GDQJEELBMFVTFN-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |