C9H18N2O3 — CID 79155189
N-(2,3-dihydroxypropyl)piperidine-1-carboxamide (PubChem CID 79155189) has the molecular formula C9H18N2O3 and a molecular weight of 202.25 g/mol. Its IUPAC name is N-(2,3-dihydroxypropyl)piperidine-1-carboxamide.
| Compound Name | N-(2,3-dihydroxypropyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 79155189 |
| Molecular Formula | C9H18N2O3 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.13 |
| IUPAC Name | N-(2,3-dihydroxypropyl)piperidine-1-carboxamide |
| SMILES | O=C(NCC(O)CO)N1CCCCC1 |
| InChI | InChI=1S/C9H18N2O3/c12-7-8(13)6-10-9(14)11-4-2-1-3-5-11/h8,12-13H,1-7H2,(H,10,14) |
| InChIKey | WNJFLFBDJCCILU-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |