C16H15N3O2 — CID 79157325
6-methyl-2-[[3-(1,3-oxazol-5-yl)anilino]methyl]pyridin-3-ol (PubChem CID 79157325) has the molecular formula C16H15N3O2 and a molecular weight of 281.31 g/mol. Its IUPAC name is 6-methyl-2-[[3-(1,3-oxazol-5-yl)anilino]methyl]pyridin-3-ol.
| Compound Name | 6-methyl-2-[[3-(1,3-oxazol-5-yl)anilino]methyl]pyridin-3-ol |
|---|---|
| PubChem CID | 79157325 |
| Molecular Formula | C16H15N3O2 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 6-methyl-2-[[3-(1,3-oxazol-5-yl)anilino]methyl]pyridin-3-ol |
| SMILES | Cc1ccc(O)c(CNc2cccc(-c3cnco3)c2)n1 |
| InChI | InChI=1S/C16H15N3O2/c1-11-5-6-15(20)14(19-11)8-18-13-4-2-3-12(7-13)16-9-17-10-21-16/h2-7,9-10,18,20H,8H2,1H3 |
| InChIKey | LFEJVIZMZFQVBM-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 71.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |