C10H13NO4 — CID 79159018
2-[[2-(hydroxymethyl)-6-methyl-3-pyridinyl]oxy]propanoic acid (PubChem CID 79159018) has the molecular formula C10H13NO4 and a molecular weight of 211.22 g/mol. Its IUPAC name is 2-[[2-(hydroxymethyl)-6-methyl-3-pyridinyl]oxy]propanoic acid.
| Compound Name | 2-[[2-(hydroxymethyl)-6-methyl-3-pyridinyl]oxy]propanoic acid |
|---|---|
| PubChem CID | 79159018 |
| Molecular Formula | C10H13NO4 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 2-[[2-(hydroxymethyl)-6-methyl-3-pyridinyl]oxy]propanoic acid |
| SMILES | Cc1ccc(OC(C)C(=O)O)c(CO)n1 |
| InChI | InChI=1S/C10H13NO4/c1-6-3-4-9(8(5-12)11-6)15-7(2)10(13)14/h3-4,7,12H,5H2,1-2H3,(H,13,14) |
| InChIKey | NZORGNPUEKYHGS-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 79.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |