C12H19N3O — CID 79159501
1-[(4-aminophenyl)methyl]-3-ethyl-1,3-dimethylurea (PubChem CID 79159501) has the molecular formula C12H19N3O and a molecular weight of 221.30 g/mol. Its IUPAC name is 1-[(4-aminophenyl)methyl]-3-ethyl-1,3-dimethylurea.
| Compound Name | 1-[(4-aminophenyl)methyl]-3-ethyl-1,3-dimethylurea |
|---|---|
| PubChem CID | 79159501 |
| Molecular Formula | C12H19N3O |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.15 |
| IUPAC Name | 1-[(4-aminophenyl)methyl]-3-ethyl-1,3-dimethylurea |
| SMILES | CCN(C)C(=O)N(C)Cc1ccc(N)cc1 |
| InChI | InChI=1S/C12H19N3O/c1-4-14(2)12(16)15(3)9-10-5-7-11(13)8-6-10/h5-8H,4,9,13H2,1-3H3 |
| InChIKey | XOWVCBKEKWSXPG-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|