C9H19N3OS — CID 79160138
3-(1-amino-1-sulfanylidenepentan-2-yl)-1-ethyl-1-methylurea (PubChem CID 79160138) has the molecular formula C9H19N3OS and a molecular weight of 217.34 g/mol. Its IUPAC name is 3-(1-amino-1-sulfanylidenepentan-2-yl)-1-ethyl-1-methylurea.
| Compound Name | 3-(1-amino-1-sulfanylidenepentan-2-yl)-1-ethyl-1-methylurea |
|---|---|
| PubChem CID | 79160138 |
| Molecular Formula | C9H19N3OS |
| Molecular Weight | 217.34 g/mol |
| Exact Mass | 217.12 |
| IUPAC Name | 3-(1-amino-1-sulfanylidenepentan-2-yl)-1-ethyl-1-methylurea |
| SMILES | CCCC(NC(=O)N(C)CC)C(N)=S |
| InChI | InChI=1S/C9H19N3OS/c1-4-6-7(8(10)14)11-9(13)12(3)5-2/h7H,4-6H2,1-3H3,(H2,10,14)(H,11,13) |
| InChIKey | CVRPYOVRNSAQNV-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.34 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|