C10H17N3O — CID 79160605
N-(1-cyanoethyl)-4-methylpiperidine-1-carboxamide (PubChem CID 79160605) has the molecular formula C10H17N3O and a molecular weight of 195.27 g/mol. Its IUPAC name is N-(1-cyanoethyl)-4-methylpiperidine-1-carboxamide.
| Compound Name | N-(1-cyanoethyl)-4-methylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 79160605 |
| Molecular Formula | C10H17N3O |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | N-(1-cyanoethyl)-4-methylpiperidine-1-carboxamide |
| SMILES | CC1CCN(C(=O)NC(C)C#N)CC1 |
| InChI | InChI=1S/C10H17N3O/c1-8-3-5-13(6-4-8)10(14)12-9(2)7-11/h8-9H,3-6H2,1-2H3,(H,12,14) |
| InChIKey | LOLFCZCXWUALTI-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |