About 1-(cyanomethyl)-3,3-diethyl-1-propylurea
1-(cyanomethyl)-3,3-diethyl-1-propylurea (PubChem CID 79161064) has the molecular formula C10H19N3O
and a molecular weight of 197.28 g/mol. Its IUPAC name is 1-(cyanomethyl)-3,3-diethyl-1-propylurea.
Molecular Properties
| Compound Name | 1-(cyanomethyl)-3,3-diethyl-1-propylurea |
| PubChem CID | 79161064 |
| Molecular Formula | C10H19N3O |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.15 |
| IUPAC Name | 1-(cyanomethyl)-3,3-diethyl-1-propylurea |
| SMILES | CCCN(CC#N)C(=O)N(CC)CC |
| InChI | InChI=1S/C10H19N3O/c1-4-8-13(9-7-11)10(14)12(5-2)6-3/h4-6,8-9H2,1-3H3 |
| InChIKey | QINVFZNHTAZZJG-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|
Analyze 1-(cyanomethyl)-3,3-diethyl-1-propylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(cyanomethyl)-3,3-diethyl-1-propylurea?
The IUPAC name of 1-(cyanomethyl)-3,3-diethyl-1-propylurea (CID 79161064) is 1-(cyanomethyl)-3,3-diethyl-1-propylurea.
What is the SMILES notation for 1-(cyanomethyl)-3,3-diethyl-1-propylurea?
The canonical SMILES for 1-(cyanomethyl)-3,3-diethyl-1-propylurea is CCCN(CC#N)C(=O)N(CC)CC.
What is the InChIKey of 1-(cyanomethyl)-3,3-diethyl-1-propylurea?
The InChIKey is QINVFZNHTAZZJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N3O/c1-4-8-13(9-7-11)10(14)12(5-2)6-3/h4-6,8-9H2,1-3H3.
What are the key properties of 1-(cyanomethyl)-3,3-diethyl-1-propylurea?
1-(cyanomethyl)-3,3-diethyl-1-propylurea has a molecular weight of 197.28 g/mol, XLogP of 1.68, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(cyanomethyl)-3,3-diethyl-1-propylurea is sourced from PubChem (CID 79161064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).