C9H16N4O — CID 79161079
1,1-diethyl-3-(1H-imidazol-5-ylmethyl)urea (PubChem CID 79161079) has the molecular formula C9H16N4O and a molecular weight of 196.25 g/mol. Its IUPAC name is 1,1-diethyl-3-(1H-imidazol-5-ylmethyl)urea.
| Compound Name | 1,1-diethyl-3-(1H-imidazol-5-ylmethyl)urea |
|---|---|
| PubChem CID | 79161079 |
| Molecular Formula | C9H16N4O |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | 1,1-diethyl-3-(1H-imidazol-5-ylmethyl)urea |
| SMILES | CCN(CC)C(=O)NCc1cnc[nH]1 |
| InChI | InChI=1S/C9H16N4O/c1-3-13(4-2)9(14)11-6-8-5-10-7-12-8/h5,7H,3-4,6H2,1-2H3,(H,10,12)(H,11,14) |
| InChIKey | XENGLPHUCUKGFS-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |