About 1-(3-amino-3-iminopropyl)-3,3-diethyl-1-phenylurea
1-(3-amino-3-iminopropyl)-3,3-diethyl-1-phenylurea (PubChem CID 79161303) has the molecular formula C14H22N4O
and a molecular weight of 262.36 g/mol. Its IUPAC name is 1-(3-amino-3-iminopropyl)-3,3-diethyl-1-phenylurea.
Molecular Properties
| Compound Name | 1-(3-amino-3-iminopropyl)-3,3-diethyl-1-phenylurea |
| PubChem CID | 79161303 |
| Molecular Formula | C14H22N4O |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | 1-(3-amino-3-iminopropyl)-3,3-diethyl-1-phenylurea |
| SMILES | [H]/N=C(\N)CCN(C(=O)N(CC)CC)c1ccccc1 |
| InChI | InChI=1S/C14H22N4O/c1-3-17(4-2)14(19)18(11-10-13(15)16)12-8-6-5-7-9-12/h5-9H,3-4,10-11H2,1-2H3,(H3,15,16) |
| InChIKey | XQKNVOJFCXAAFH-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 73.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-amino-3-iminopropyl)-3,3-diethyl-1-phenylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-amino-3-iminopropyl)-3,3-diethyl-1-phenylurea?
The IUPAC name of 1-(3-amino-3-iminopropyl)-3,3-diethyl-1-phenylurea (CID 79161303) is 1-(3-amino-3-iminopropyl)-3,3-diethyl-1-phenylurea.
What is the SMILES notation for 1-(3-amino-3-iminopropyl)-3,3-diethyl-1-phenylurea?
The canonical SMILES for 1-(3-amino-3-iminopropyl)-3,3-diethyl-1-phenylurea is [H]/N=C(\N)CCN(C(=O)N(CC)CC)c1ccccc1.
What is the InChIKey of 1-(3-amino-3-iminopropyl)-3,3-diethyl-1-phenylurea?
The InChIKey is XQKNVOJFCXAAFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N4O/c1-3-17(4-2)14(19)18(11-10-13(15)16)12-8-6-5-7-9-12/h5-9H,3-4,10-11H2,1-2H3,(H3,15,16).
What are the key properties of 1-(3-amino-3-iminopropyl)-3,3-diethyl-1-phenylurea?
1-(3-amino-3-iminopropyl)-3,3-diethyl-1-phenylurea has a molecular weight of 262.36 g/mol, XLogP of 2.28, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-amino-3-iminopropyl)-3,3-diethyl-1-phenylurea is sourced from PubChem (CID 79161303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).