About 3-(2-amino-1-cyclohexyl-2-iminoethyl)-1,1-diethylurea
3-(2-amino-1-cyclohexyl-2-iminoethyl)-1,1-diethylurea (PubChem CID 79161304) has the molecular formula C13H26N4O
and a molecular weight of 254.38 g/mol. Its IUPAC name is 3-(2-amino-1-cyclohexyl-2-iminoethyl)-1,1-diethylurea.
Molecular Properties
| Compound Name | 3-(2-amino-1-cyclohexyl-2-iminoethyl)-1,1-diethylurea |
| PubChem CID | 79161304 |
| Molecular Formula | C13H26N4O |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.21 |
| IUPAC Name | 3-(2-amino-1-cyclohexyl-2-iminoethyl)-1,1-diethylurea |
| SMILES | [H]/N=C(\N)C(NC(=O)N(CC)CC)C1CCCCC1 |
| InChI | InChI=1S/C13H26N4O/c1-3-17(4-2)13(18)16-11(12(14)15)10-8-6-5-7-9-10/h10-11H,3-9H2,1-2H3,(H3,14,15)(H,16,18) |
| InChIKey | RYKLKSBXWMMBPA-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 82.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-amino-1-cyclohexyl-2-iminoethyl)-1,1-diethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-amino-1-cyclohexyl-2-iminoethyl)-1,1-diethylurea?
The IUPAC name of 3-(2-amino-1-cyclohexyl-2-iminoethyl)-1,1-diethylurea (CID 79161304) is 3-(2-amino-1-cyclohexyl-2-iminoethyl)-1,1-diethylurea.
What is the SMILES notation for 3-(2-amino-1-cyclohexyl-2-iminoethyl)-1,1-diethylurea?
The canonical SMILES for 3-(2-amino-1-cyclohexyl-2-iminoethyl)-1,1-diethylurea is [H]/N=C(\N)C(NC(=O)N(CC)CC)C1CCCCC1.
What is the InChIKey of 3-(2-amino-1-cyclohexyl-2-iminoethyl)-1,1-diethylurea?
The InChIKey is RYKLKSBXWMMBPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26N4O/c1-3-17(4-2)13(18)16-11(12(14)15)10-8-6-5-7-9-10/h10-11H,3-9H2,1-2H3,(H3,14,15)(H,16,18).
What are the key properties of 3-(2-amino-1-cyclohexyl-2-iminoethyl)-1,1-diethylurea?
3-(2-amino-1-cyclohexyl-2-iminoethyl)-1,1-diethylurea has a molecular weight of 254.38 g/mol, XLogP of 1.92, 5 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-amino-1-cyclohexyl-2-iminoethyl)-1,1-diethylurea is sourced from PubChem (CID 79161304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).