C11H21N3O — CID 79161578
(3aS,6aS)-N,N-diethyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole-1-carboxamide (PubChem CID 79161578) has the molecular formula C11H21N3O and a molecular weight of 211.31 g/mol. Its IUPAC name is (3aS,6aS)-N,N-diethyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole-1-carboxamide.
| Compound Name | (3aS,6aS)-N,N-diethyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole-1-carboxamide |
|---|---|
| PubChem CID | 79161578 |
| Molecular Formula | C11H21N3O |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.17 |
| IUPAC Name | (3aS,6aS)-N,N-diethyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole-1-carboxamide |
| SMILES | CCN(CC)C(=O)N1CC[C@H]2CNC[C@H]21 |
| InChI | InChI=1S/C11H21N3O/c1-3-13(4-2)11(15)14-6-5-9-7-12-8-10(9)14/h9-10,12H,3-8H2,1-2H3/t9-,10+/m0/s1 |
| InChIKey | RSLBDPCJLYYTFP-VHSXEESVSA-N |
| XLogP | 0.74 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |