About 4-(2-cyanopropan-2-yl)-N,N-diethylpiperazine-1-carboxamide
4-(2-cyanopropan-2-yl)-N,N-diethylpiperazine-1-carboxamide (PubChem CID 79161762) has the molecular formula C13H24N4O
and a molecular weight of 252.36 g/mol. Its IUPAC name is 4-(2-cyanopropan-2-yl)-N,N-diethylpiperazine-1-carboxamide.
Molecular Properties
| Compound Name | 4-(2-cyanopropan-2-yl)-N,N-diethylpiperazine-1-carboxamide |
| PubChem CID | 79161762 |
| Molecular Formula | C13H24N4O |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.20 |
| IUPAC Name | 4-(2-cyanopropan-2-yl)-N,N-diethylpiperazine-1-carboxamide |
| SMILES | CCN(CC)C(=O)N1CCN(C(C)(C)C#N)CC1 |
| InChI | InChI=1S/C13H24N4O/c1-5-15(6-2)12(18)16-7-9-17(10-8-16)13(3,4)11-14/h5-10H2,1-4H3 |
| InChIKey | DYWKKOGYVFYTHA-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 50.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(2-cyanopropan-2-yl)-N,N-diethylpiperazine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-cyanopropan-2-yl)-N,N-diethylpiperazine-1-carboxamide?
The IUPAC name of 4-(2-cyanopropan-2-yl)-N,N-diethylpiperazine-1-carboxamide (CID 79161762) is 4-(2-cyanopropan-2-yl)-N,N-diethylpiperazine-1-carboxamide.
What is the SMILES notation for 4-(2-cyanopropan-2-yl)-N,N-diethylpiperazine-1-carboxamide?
The canonical SMILES for 4-(2-cyanopropan-2-yl)-N,N-diethylpiperazine-1-carboxamide is CCN(CC)C(=O)N1CCN(C(C)(C)C#N)CC1.
What is the InChIKey of 4-(2-cyanopropan-2-yl)-N,N-diethylpiperazine-1-carboxamide?
The InChIKey is DYWKKOGYVFYTHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24N4O/c1-5-15(6-2)12(18)16-7-9-17(10-8-16)13(3,4)11-14/h5-10H2,1-4H3.
What are the key properties of 4-(2-cyanopropan-2-yl)-N,N-diethylpiperazine-1-carboxamide?
4-(2-cyanopropan-2-yl)-N,N-diethylpiperazine-1-carboxamide has a molecular weight of 252.36 g/mol, XLogP of 1.37, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-cyanopropan-2-yl)-N,N-diethylpiperazine-1-carboxamide is sourced from PubChem (CID 79161762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).