C12H24N2O2 — CID 79161969
1-cyclopentyl-3,3-diethyl-1-(2-hydroxyethyl)urea (PubChem CID 79161969) has the molecular formula C12H24N2O2 and a molecular weight of 228.34 g/mol. Its IUPAC name is 1-cyclopentyl-3,3-diethyl-1-(2-hydroxyethyl)urea.
| Compound Name | 1-cyclopentyl-3,3-diethyl-1-(2-hydroxyethyl)urea |
|---|---|
| PubChem CID | 79161969 |
| Molecular Formula | C12H24N2O2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.18 |
| IUPAC Name | 1-cyclopentyl-3,3-diethyl-1-(2-hydroxyethyl)urea |
| SMILES | CCN(CC)C(=O)N(CCO)C1CCCC1 |
| InChI | InChI=1S/C12H24N2O2/c1-3-13(4-2)12(16)14(9-10-15)11-7-5-6-8-11/h11,15H,3-10H2,1-2H3 |
| InChIKey | UDKGKCGGRMWGHN-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |