C13H24N4O2 — CID 79162942
N-methyl-1-(4-methylpiperidine-1-carbonyl)piperazine-2-carboxamide (PubChem CID 79162942) has the molecular formula C13H24N4O2 and a molecular weight of 268.36 g/mol. Its IUPAC name is N-methyl-1-(4-methylpiperidine-1-carbonyl)piperazine-2-carboxamide.
| Compound Name | N-methyl-1-(4-methylpiperidine-1-carbonyl)piperazine-2-carboxamide |
|---|---|
| PubChem CID | 79162942 |
| Molecular Formula | C13H24N4O2 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | N-methyl-1-(4-methylpiperidine-1-carbonyl)piperazine-2-carboxamide |
| SMILES | CNC(=O)C1CNCCN1C(=O)N1CCC(C)CC1 |
| InChI | InChI=1S/C13H24N4O2/c1-10-3-6-16(7-4-10)13(19)17-8-5-15-9-11(17)12(18)14-2/h10-11,15H,3-9H2,1-2H3,(H,14,18) |
| InChIKey | KXQPOUYFOLRLKZ-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |