C9H18N4O — CID 79163516
3-(2-amino-1-cyclopropyl-2-iminoethyl)-1-ethyl-1-methylurea (PubChem CID 79163516) has the molecular formula C9H18N4O and a molecular weight of 198.27 g/mol. Its IUPAC name is 3-(2-amino-1-cyclopropyl-2-iminoethyl)-1-ethyl-1-methylurea.
| Compound Name | 3-(2-amino-1-cyclopropyl-2-iminoethyl)-1-ethyl-1-methylurea |
|---|---|
| PubChem CID | 79163516 |
| Molecular Formula | C9H18N4O |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.15 |
| IUPAC Name | 3-(2-amino-1-cyclopropyl-2-iminoethyl)-1-ethyl-1-methylurea |
| SMILES | [H]/N=C(\N)C(NC(=O)N(C)CC)C1CC1 |
| InChI | InChI=1S/C9H18N4O/c1-3-13(2)9(14)12-7(8(10)11)6-4-5-6/h6-7H,3-5H2,1-2H3,(H3,10,11)(H,12,14) |
| InChIKey | BZFMRRPBBYBOIK-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 82.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|