C13H12F2N2O — CID 79163518
2-[(3,4-difluoroanilino)methyl]-6-methylpyridin-3-ol (PubChem CID 79163518) has the molecular formula C13H12F2N2O and a molecular weight of 250.25 g/mol. Its IUPAC name is 2-[(3,4-difluoroanilino)methyl]-6-methylpyridin-3-ol.
| Compound Name | 2-[(3,4-difluoroanilino)methyl]-6-methylpyridin-3-ol |
|---|---|
| PubChem CID | 79163518 |
| Molecular Formula | C13H12F2N2O |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | 2-[(3,4-difluoroanilino)methyl]-6-methylpyridin-3-ol |
| SMILES | Cc1ccc(O)c(CNc2ccc(F)c(F)c2)n1 |
| InChI | InChI=1S/C13H12F2N2O/c1-8-2-5-13(18)12(17-8)7-16-9-3-4-10(14)11(15)6-9/h2-6,16,18H,7H2,1H3 |
| InChIKey | JPCFTURNXIARJP-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |