About N-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methyl]-4-methylpentan-1-amine
N-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methyl]-4-methylpentan-1-amine (PubChem CID 79163928) has the molecular formula C13H19BrN4
and a molecular weight of 311.23 g/mol. Its IUPAC name is N-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methyl]-4-methylpentan-1-amine.
Molecular Properties
| Compound Name | N-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methyl]-4-methylpentan-1-amine |
| PubChem CID | 79163928 |
| Molecular Formula | C13H19BrN4 |
| Molecular Weight | 311.23 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | N-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methyl]-4-methylpentan-1-amine |
| SMILES | CC(C)CCCNCc1cnc2cnc(Br)cn12 |
| InChI | InChI=1S/C13H19BrN4/c1-10(2)4-3-5-15-6-11-7-17-13-8-16-12(14)9-18(11)13/h7-10,15H,3-6H2,1-2H3 |
| InChIKey | ZNENUFVZVOQSAK-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.23 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methyl]-4-methylpentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methyl]-4-methylpentan-1-amine?
The IUPAC name of N-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methyl]-4-methylpentan-1-amine (CID 79163928) is N-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methyl]-4-methylpentan-1-amine.
What is the SMILES notation for N-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methyl]-4-methylpentan-1-amine?
The canonical SMILES for N-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methyl]-4-methylpentan-1-amine is CC(C)CCCNCc1cnc2cnc(Br)cn12.
What is the InChIKey of N-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methyl]-4-methylpentan-1-amine?
The InChIKey is ZNENUFVZVOQSAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19BrN4/c1-10(2)4-3-5-15-6-11-7-17-13-8-16-12(14)9-18(11)13/h7-10,15H,3-6H2,1-2H3.
What are the key properties of N-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methyl]-4-methylpentan-1-amine?
N-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methyl]-4-methylpentan-1-amine has a molecular weight of 311.23 g/mol, XLogP of 3.02, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methyl]-4-methylpentan-1-amine is sourced from PubChem (CID 79163928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).