About 2-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methylamino]propane-1,3-diol
2-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methylamino]propane-1,3-diol (PubChem CID 79163945) has the molecular formula C10H13BrN4O2
and a molecular weight of 301.14 g/mol. Its IUPAC name is 2-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methylamino]propane-1,3-diol.
Molecular Properties
| Compound Name | 2-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methylamino]propane-1,3-diol |
| PubChem CID | 79163945 |
| Molecular Formula | C10H13BrN4O2 |
| Molecular Weight | 301.14 g/mol |
| Exact Mass | 300.02 |
| IUPAC Name | 2-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methylamino]propane-1,3-diol |
| SMILES | OCC(CO)NCc1cnc2cnc(Br)cn12 |
| InChI | InChI=1S/C10H13BrN4O2/c11-9-4-15-8(1-12-7(5-16)6-17)2-14-10(15)3-13-9/h2-4,7,12,16-17H,1,5-6H2 |
| InChIKey | WPKGDIDMQXPSPV-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 82.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.14 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methylamino]propane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methylamino]propane-1,3-diol?
The IUPAC name of 2-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methylamino]propane-1,3-diol (CID 79163945) is 2-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methylamino]propane-1,3-diol.
What is the SMILES notation for 2-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methylamino]propane-1,3-diol?
The canonical SMILES for 2-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methylamino]propane-1,3-diol is OCC(CO)NCc1cnc2cnc(Br)cn12.
What is the InChIKey of 2-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methylamino]propane-1,3-diol?
The InChIKey is WPKGDIDMQXPSPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13BrN4O2/c11-9-4-15-8(1-12-7(5-16)6-17)2-14-10(15)3-13-9/h2-4,7,12,16-17H,1,5-6H2.
What are the key properties of 2-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methylamino]propane-1,3-diol?
2-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methylamino]propane-1,3-diol has a molecular weight of 301.14 g/mol, XLogP of -0.07, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methylamino]propane-1,3-diol is sourced from PubChem (CID 79163945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).