About 3-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methylamino]-N,N-dimethylpropanamide
3-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methylamino]-N,N-dimethylpropanamide (PubChem CID 79164137) has the molecular formula C12H16BrN5O
and a molecular weight of 326.20 g/mol. Its IUPAC name is 3-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methylamino]-N,N-dimethylpropanamide.
Molecular Properties
| Compound Name | 3-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methylamino]-N,N-dimethylpropanamide |
| PubChem CID | 79164137 |
| Molecular Formula | C12H16BrN5O |
| Molecular Weight | 326.20 g/mol |
| Exact Mass | 325.05 |
| IUPAC Name | 3-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methylamino]-N,N-dimethylpropanamide |
| SMILES | CN(C)C(=O)CCNCc1cnc2cnc(Br)cn12 |
| InChI | InChI=1S/C12H16BrN5O/c1-17(2)12(19)3-4-14-5-9-6-16-11-7-15-10(13)8-18(9)11/h6-8,14H,3-5H2,1-2H3 |
| InChIKey | GKUNMRRNLYMGLU-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 62.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.20 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methylamino]-N,N-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methylamino]-N,N-dimethylpropanamide?
The IUPAC name of 3-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methylamino]-N,N-dimethylpropanamide (CID 79164137) is 3-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methylamino]-N,N-dimethylpropanamide.
What is the SMILES notation for 3-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methylamino]-N,N-dimethylpropanamide?
The canonical SMILES for 3-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methylamino]-N,N-dimethylpropanamide is CN(C)C(=O)CCNCc1cnc2cnc(Br)cn12.
What is the InChIKey of 3-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methylamino]-N,N-dimethylpropanamide?
The InChIKey is GKUNMRRNLYMGLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16BrN5O/c1-17(2)12(19)3-4-14-5-9-6-16-11-7-15-10(13)8-18(9)11/h6-8,14H,3-5H2,1-2H3.
What are the key properties of 3-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methylamino]-N,N-dimethylpropanamide?
3-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methylamino]-N,N-dimethylpropanamide has a molecular weight of 326.20 g/mol, XLogP of 1.06, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methylamino]-N,N-dimethylpropanamide is sourced from PubChem (CID 79164137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).