About N-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methyl]-2,6-dichloroaniline
N-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methyl]-2,6-dichloroaniline (PubChem CID 79164376) has the molecular formula C13H9BrCl2N4
and a molecular weight of 372.05 g/mol. Its IUPAC name is N-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methyl]-2,6-dichloroaniline.
Molecular Properties
| Compound Name | N-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methyl]-2,6-dichloroaniline |
| PubChem CID | 79164376 |
| Molecular Formula | C13H9BrCl2N4 |
| Molecular Weight | 372.05 g/mol |
| Exact Mass | 369.94 |
| IUPAC Name | N-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methyl]-2,6-dichloroaniline |
| SMILES | Clc1cccc(Cl)c1NCc1cnc2cnc(Br)cn12 |
| InChI | InChI=1S/C13H9BrCl2N4/c14-11-7-20-8(4-18-12(20)6-17-11)5-19-13-9(15)2-1-3-10(13)16/h1-4,6-7,19H,5H2 |
| InChIKey | KWMKMSTXRROBAF-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.05 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methyl]-2,6-dichloroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methyl]-2,6-dichloroaniline?
The IUPAC name of N-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methyl]-2,6-dichloroaniline (CID 79164376) is N-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methyl]-2,6-dichloroaniline.
What is the SMILES notation for N-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methyl]-2,6-dichloroaniline?
The canonical SMILES for N-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methyl]-2,6-dichloroaniline is Clc1cccc(Cl)c1NCc1cnc2cnc(Br)cn12.
What is the InChIKey of N-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methyl]-2,6-dichloroaniline?
The InChIKey is KWMKMSTXRROBAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9BrCl2N4/c14-11-7-20-8(4-18-12(20)6-17-11)5-19-13-9(15)2-1-3-10(13)16/h1-4,6-7,19H,5H2.
What are the key properties of N-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methyl]-2,6-dichloroaniline?
N-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methyl]-2,6-dichloroaniline has a molecular weight of 372.05 g/mol, XLogP of 4.41, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methyl]-2,6-dichloroaniline is sourced from PubChem (CID 79164376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).