C18H20N2O — CID 79164896
1-[6-methyl-3-(3-phenylprop-2-ynoxy)-2-pyridinyl]propan-2-amine (PubChem CID 79164896) has the molecular formula C18H20N2O and a molecular weight of 280.37 g/mol. Its IUPAC name is 1-[6-methyl-3-(3-phenylprop-2-ynoxy)-2-pyridinyl]propan-2-amine.
| Compound Name | 1-[6-methyl-3-(3-phenylprop-2-ynoxy)-2-pyridinyl]propan-2-amine |
|---|---|
| PubChem CID | 79164896 |
| Molecular Formula | C18H20N2O |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 1-[6-methyl-3-(3-phenylprop-2-ynoxy)-2-pyridinyl]propan-2-amine |
| SMILES | Cc1ccc(OCC#Cc2ccccc2)c(CC(C)N)n1 |
| InChI | InChI=1S/C18H20N2O/c1-14(19)13-17-18(11-10-15(2)20-17)21-12-6-9-16-7-4-3-5-8-16/h3-5,7-8,10-11,14H,12-13,19H2,1-2H3 |
| InChIKey | IJULSOPHMLMPPE-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|