C19H25NO — CID 79166452
N-ethyl-1-[3-(2,3,6-trimethylphenoxy)phenyl]ethanamine (PubChem CID 79166452) has the molecular formula C19H25NO and a molecular weight of 283.42 g/mol. Its IUPAC name is N-ethyl-1-[3-(2,3,6-trimethylphenoxy)phenyl]ethanamine.
| Compound Name | N-ethyl-1-[3-(2,3,6-trimethylphenoxy)phenyl]ethanamine |
|---|---|
| PubChem CID | 79166452 |
| Molecular Formula | C19H25NO |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | N-ethyl-1-[3-(2,3,6-trimethylphenoxy)phenyl]ethanamine |
| SMILES | CCNC(C)c1cccc(Oc2c(C)ccc(C)c2C)c1 |
| InChI | InChI=1S/C19H25NO/c1-6-20-16(5)17-8-7-9-18(12-17)21-19-14(3)11-10-13(2)15(19)4/h7-12,16,20H,6H2,1-5H3 |
| InChIKey | SHBSWHUWZUBESO-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |