C15H21ClN4O — CID 79166568
4-chloro-N'-hydroxy-2-(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)benzenecarboximidamide (PubChem CID 79166568) has the molecular formula C15H21ClN4O and a molecular weight of 308.81 g/mol. Its IUPAC name is 4-chloro-N'-hydroxy-2-(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)benzenecarboximidamide.
| Compound Name | 4-chloro-N'-hydroxy-2-(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)benzenecarboximidamide |
|---|---|
| PubChem CID | 79166568 |
| Molecular Formula | C15H21ClN4O |
| Molecular Weight | 308.81 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 4-chloro-N'-hydroxy-2-(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)benzenecarboximidamide |
| SMILES | CN1C2CCC1CN(c1cc(Cl)ccc1C(N)=NO)CC2 |
| InChI | InChI=1S/C15H21ClN4O/c1-19-11-3-4-12(19)9-20(7-6-11)14-8-10(16)2-5-13(14)15(17)18-21/h2,5,8,11-12,21H,3-4,6-7,9H2,1H3,(H2,17,18) |
| InChIKey | INOOTBIRAOGJPE-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 65.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.81 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|