C13H19BrN2O2 — CID 79167033
5-bromo-2-[(4-ethylmorpholin-2-yl)methoxy]aniline (PubChem CID 79167033) has the molecular formula C13H19BrN2O2 and a molecular weight of 315.21 g/mol. Its IUPAC name is 5-bromo-2-[(4-ethylmorpholin-2-yl)methoxy]aniline.
| Compound Name | 5-bromo-2-[(4-ethylmorpholin-2-yl)methoxy]aniline |
|---|---|
| PubChem CID | 79167033 |
| Molecular Formula | C13H19BrN2O2 |
| Molecular Weight | 315.21 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | 5-bromo-2-[(4-ethylmorpholin-2-yl)methoxy]aniline |
| SMILES | CCN1CCOC(COc2ccc(Br)cc2N)C1 |
| InChI | InChI=1S/C13H19BrN2O2/c1-2-16-5-6-17-11(8-16)9-18-13-4-3-10(14)7-12(13)15/h3-4,7,11H,2,5-6,8-9,15H2,1H3 |
| InChIKey | HXKBJYKCBDZTFX-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.21 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|