C10H17Cl2NO — CID 79167559
1-[(2,3-dichloroprop-2-enylamino)methyl]cyclohexan-1-ol (PubChem CID 79167559) has the molecular formula C10H17Cl2NO and a molecular weight of 238.16 g/mol. Its IUPAC name is 1-[(2,3-dichloroprop-2-enylamino)methyl]cyclohexan-1-ol.
| Compound Name | 1-[(2,3-dichloroprop-2-enylamino)methyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 79167559 |
| Molecular Formula | C10H17Cl2NO |
| Molecular Weight | 238.16 g/mol |
| Exact Mass | 237.07 |
| IUPAC Name | 1-[(2,3-dichloroprop-2-enylamino)methyl]cyclohexan-1-ol |
| SMILES | OC1(CNCC(Cl)=CCl)CCCCC1 |
| InChI | InChI=1S/C10H17Cl2NO/c11-6-9(12)7-13-8-10(14)4-2-1-3-5-10/h6,13-14H,1-5,7-8H2 |
| InChIKey | RKYSGBKIIZLQCZ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.16 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |