C10H18Cl2N2 — CID 79167933
2,3-dichloro-N-(3-pyrrolidin-1-ylpropyl)prop-2-en-1-amine (PubChem CID 79167933) has the molecular formula C10H18Cl2N2 and a molecular weight of 237.17 g/mol. Its IUPAC name is 2,3-dichloro-N-(3-pyrrolidin-1-ylpropyl)prop-2-en-1-amine.
| Compound Name | 2,3-dichloro-N-(3-pyrrolidin-1-ylpropyl)prop-2-en-1-amine |
|---|---|
| PubChem CID | 79167933 |
| Molecular Formula | C10H18Cl2N2 |
| Molecular Weight | 237.17 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 2,3-dichloro-N-(3-pyrrolidin-1-ylpropyl)prop-2-en-1-amine |
| SMILES | ClC=C(Cl)CNCCCN1CCCC1 |
| InChI | InChI=1S/C10H18Cl2N2/c11-8-10(12)9-13-4-3-7-14-5-1-2-6-14/h8,13H,1-7,9H2 |
| InChIKey | ATNUEDWCQFOWFC-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.17 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|