About N-(2,3-dichloroprop-2-enyl)-3-methyl-1,1-dioxothiolan-3-amine
N-(2,3-dichloroprop-2-enyl)-3-methyl-1,1-dioxothiolan-3-amine (PubChem CID 79168317) has the molecular formula C8H13Cl2NO2S
and a molecular weight of 258.17 g/mol. Its IUPAC name is N-(2,3-dichloroprop-2-enyl)-3-methyl-1,1-dioxothiolan-3-amine.
Molecular Properties
| Compound Name | N-(2,3-dichloroprop-2-enyl)-3-methyl-1,1-dioxothiolan-3-amine |
| PubChem CID | 79168317 |
| Molecular Formula | C8H13Cl2NO2S |
| Molecular Weight | 258.17 g/mol |
| Exact Mass | 257.00 |
| IUPAC Name | N-(2,3-dichloroprop-2-enyl)-3-methyl-1,1-dioxothiolan-3-amine |
| SMILES | CC1(NCC(Cl)=CCl)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C8H13Cl2NO2S/c1-8(11-5-7(10)4-9)2-3-14(12,13)6-8/h4,11H,2-3,5-6H2,1H3 |
| InChIKey | UXPRCLWGBVCOHZ-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.17 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(2,3-dichloroprop-2-enyl)-3-methyl-1,1-dioxothiolan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,3-dichloroprop-2-enyl)-3-methyl-1,1-dioxothiolan-3-amine?
The IUPAC name of N-(2,3-dichloroprop-2-enyl)-3-methyl-1,1-dioxothiolan-3-amine (CID 79168317) is N-(2,3-dichloroprop-2-enyl)-3-methyl-1,1-dioxothiolan-3-amine.
What is the SMILES notation for N-(2,3-dichloroprop-2-enyl)-3-methyl-1,1-dioxothiolan-3-amine?
The canonical SMILES for N-(2,3-dichloroprop-2-enyl)-3-methyl-1,1-dioxothiolan-3-amine is CC1(NCC(Cl)=CCl)CCS(=O)(=O)C1.
What is the InChIKey of N-(2,3-dichloroprop-2-enyl)-3-methyl-1,1-dioxothiolan-3-amine?
The InChIKey is UXPRCLWGBVCOHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13Cl2NO2S/c1-8(11-5-7(10)4-9)2-3-14(12,13)6-8/h4,11H,2-3,5-6H2,1H3.
What are the key properties of N-(2,3-dichloroprop-2-enyl)-3-methyl-1,1-dioxothiolan-3-amine?
N-(2,3-dichloroprop-2-enyl)-3-methyl-1,1-dioxothiolan-3-amine has a molecular weight of 258.17 g/mol, XLogP of 1.47, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,3-dichloroprop-2-enyl)-3-methyl-1,1-dioxothiolan-3-amine is sourced from PubChem (CID 79168317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).