C11H15BrN2O — CID 79168660
2-[3-(2-bromoprop-2-enoxy)-6-methyl-2-pyridinyl]ethanamine (PubChem CID 79168660) has the molecular formula C11H15BrN2O and a molecular weight of 271.16 g/mol. Its IUPAC name is 2-[3-(2-bromoprop-2-enoxy)-6-methyl-2-pyridinyl]ethanamine.
| Compound Name | 2-[3-(2-bromoprop-2-enoxy)-6-methyl-2-pyridinyl]ethanamine |
|---|---|
| PubChem CID | 79168660 |
| Molecular Formula | C11H15BrN2O |
| Molecular Weight | 271.16 g/mol |
| Exact Mass | 270.04 |
| IUPAC Name | 2-[3-(2-bromoprop-2-enoxy)-6-methyl-2-pyridinyl]ethanamine |
| SMILES | C=C(Br)COc1ccc(C)nc1CCN |
| InChI | InChI=1S/C11H15BrN2O/c1-8(12)7-15-11-4-3-9(2)14-10(11)5-6-13/h3-4H,1,5-7,13H2,2H3 |
| InChIKey | IAFLKDBOSGJVOA-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.16 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |