C14H17NO2S — CID 79168779
[3-[(5-ethylthiophen-2-yl)methoxy]-6-methyl-2-pyridinyl]methanol (PubChem CID 79168779) has the molecular formula C14H17NO2S and a molecular weight of 263.36 g/mol. Its IUPAC name is [3-[(5-ethylthiophen-2-yl)methoxy]-6-methyl-2-pyridinyl]methanol.
| Compound Name | [3-[(5-ethylthiophen-2-yl)methoxy]-6-methyl-2-pyridinyl]methanol |
|---|---|
| PubChem CID | 79168779 |
| Molecular Formula | C14H17NO2S |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | [3-[(5-ethylthiophen-2-yl)methoxy]-6-methyl-2-pyridinyl]methanol |
| SMILES | CCc1ccc(COc2ccc(C)nc2CO)s1 |
| InChI | InChI=1S/C14H17NO2S/c1-3-11-5-6-12(18-11)9-17-14-7-4-10(2)15-13(14)8-16/h4-7,16H,3,8-9H2,1-2H3 |
| InChIKey | YEPKJOLWWLHMPG-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |