C22H25N3O3 — CID 7916979
2-[(4R)-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]-N-(4-propan-2-ylphenyl)acetamide (PubChem CID 7916979) has the molecular formula C22H25N3O3 and a molecular weight of 379.46 g/mol. Its IUPAC name is 2-[(4R)-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]-N-(4-propan-2-ylphenyl)acetamide.
| Compound Name | 2-[(4R)-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]-N-(4-propan-2-ylphenyl)acetamide |
|---|---|
| PubChem CID | 7916979 |
| Molecular Formula | C22H25N3O3 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | 2-[(4R)-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]-N-(4-propan-2-ylphenyl)acetamide |
| SMILES | CC(C)c1ccc(NC(=O)CN2C(=O)N[C@H](CCc3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C22H25N3O3/c1-15(2)17-9-11-18(12-10-17)23-20(26)14-25-21(27)19(24-22(25)28)13-8-16-6-4-3-5-7-16/h3-7,9-12,15,19H,8,13-14H2,1-2H3,(H,23,26)(H,24,28)/t19-/m1/s1 |
| InChIKey | OROMAHFXKHHWNI-LJQANCHMSA-N |
| XLogP | 3.30 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|