About 6-chloro-2-(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)pyridine-3-carboxylic acid
6-chloro-2-(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)pyridine-3-carboxylic acid (PubChem CID 79170050) has the molecular formula C14H18ClN3O2
and a molecular weight of 295.77 g/mol. Its IUPAC name is 6-chloro-2-(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)pyridine-3-carboxylic acid.
Molecular Properties
| Compound Name | 6-chloro-2-(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)pyridine-3-carboxylic acid |
| PubChem CID | 79170050 |
| Molecular Formula | C14H18ClN3O2 |
| Molecular Weight | 295.77 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | 6-chloro-2-(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)pyridine-3-carboxylic acid |
| SMILES | CN1C2CCC1CN(c1nc(Cl)ccc1C(=O)O)CC2 |
| InChI | InChI=1S/C14H18ClN3O2/c1-17-9-2-3-10(17)8-18(7-6-9)13-11(14(19)20)4-5-12(15)16-13/h4-5,9-10H,2-3,6-8H2,1H3,(H,19,20) |
| InChIKey | OHZKVGIUVMXXPM-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 56.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.77 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-2-(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)pyridine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-2-(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)pyridine-3-carboxylic acid?
The IUPAC name of 6-chloro-2-(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)pyridine-3-carboxylic acid (CID 79170050) is 6-chloro-2-(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)pyridine-3-carboxylic acid.
What is the SMILES notation for 6-chloro-2-(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)pyridine-3-carboxylic acid?
The canonical SMILES for 6-chloro-2-(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)pyridine-3-carboxylic acid is CN1C2CCC1CN(c1nc(Cl)ccc1C(=O)O)CC2.
What is the InChIKey of 6-chloro-2-(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)pyridine-3-carboxylic acid?
The InChIKey is OHZKVGIUVMXXPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18ClN3O2/c1-17-9-2-3-10(17)8-18(7-6-9)13-11(14(19)20)4-5-12(15)16-13/h4-5,9-10H,2-3,6-8H2,1H3,(H,19,20).
What are the key properties of 6-chloro-2-(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)pyridine-3-carboxylic acid?
6-chloro-2-(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)pyridine-3-carboxylic acid has a molecular weight of 295.77 g/mol, XLogP of 2.11, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-2-(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)pyridine-3-carboxylic acid is sourced from PubChem (CID 79170050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).