C13H21N3O — CID 79171191
4-N-methyl-4-N-[(4-methylmorpholin-2-yl)methyl]benzene-1,4-diamine (PubChem CID 79171191) has the molecular formula C13H21N3O and a molecular weight of 235.33 g/mol. Its IUPAC name is 4-N-methyl-4-N-[(4-methylmorpholin-2-yl)methyl]benzene-1,4-diamine.
| Compound Name | 4-N-methyl-4-N-[(4-methylmorpholin-2-yl)methyl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 79171191 |
| Molecular Formula | C13H21N3O |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.17 |
| IUPAC Name | 4-N-methyl-4-N-[(4-methylmorpholin-2-yl)methyl]benzene-1,4-diamine |
| SMILES | CN1CCOC(CN(C)c2ccc(N)cc2)C1 |
| InChI | InChI=1S/C13H21N3O/c1-15-7-8-17-13(9-15)10-16(2)12-5-3-11(14)4-6-12/h3-6,13H,7-10,14H2,1-2H3 |
| InChIKey | IXYNDLJMHNYVSE-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 41.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|