About N'-(2-methoxyethyl)-N'-[(4-methylmorpholin-2-yl)methyl]propane-1,3-diamine
N'-(2-methoxyethyl)-N'-[(4-methylmorpholin-2-yl)methyl]propane-1,3-diamine (PubChem CID 79171784) has the molecular formula C12H27N3O2
and a molecular weight of 245.37 g/mol. Its IUPAC name is N'-(2-methoxyethyl)-N'-[(4-methylmorpholin-2-yl)methyl]propane-1,3-diamine.
Molecular Properties
| Compound Name | N'-(2-methoxyethyl)-N'-[(4-methylmorpholin-2-yl)methyl]propane-1,3-diamine |
| PubChem CID | 79171784 |
| Molecular Formula | C12H27N3O2 |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.21 |
| IUPAC Name | N'-(2-methoxyethyl)-N'-[(4-methylmorpholin-2-yl)methyl]propane-1,3-diamine |
| SMILES | COCCN(CCCN)CC1CN(C)CCO1 |
| InChI | InChI=1S/C12H27N3O2/c1-14-6-9-17-12(10-14)11-15(5-3-4-13)7-8-16-2/h12H,3-11,13H2,1-2H3 |
| InChIKey | JHHNEOVNOQXVHM-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 50.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N'-(2-methoxyethyl)-N'-[(4-methylmorpholin-2-yl)methyl]propane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(2-methoxyethyl)-N'-[(4-methylmorpholin-2-yl)methyl]propane-1,3-diamine?
The IUPAC name of N'-(2-methoxyethyl)-N'-[(4-methylmorpholin-2-yl)methyl]propane-1,3-diamine (CID 79171784) is N'-(2-methoxyethyl)-N'-[(4-methylmorpholin-2-yl)methyl]propane-1,3-diamine.
What is the SMILES notation for N'-(2-methoxyethyl)-N'-[(4-methylmorpholin-2-yl)methyl]propane-1,3-diamine?
The canonical SMILES for N'-(2-methoxyethyl)-N'-[(4-methylmorpholin-2-yl)methyl]propane-1,3-diamine is COCCN(CCCN)CC1CN(C)CCO1.
What is the InChIKey of N'-(2-methoxyethyl)-N'-[(4-methylmorpholin-2-yl)methyl]propane-1,3-diamine?
The InChIKey is JHHNEOVNOQXVHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H27N3O2/c1-14-6-9-17-12(10-14)11-15(5-3-4-13)7-8-16-2/h12H,3-11,13H2,1-2H3.
What are the key properties of N'-(2-methoxyethyl)-N'-[(4-methylmorpholin-2-yl)methyl]propane-1,3-diamine?
N'-(2-methoxyethyl)-N'-[(4-methylmorpholin-2-yl)methyl]propane-1,3-diamine has a molecular weight of 245.37 g/mol, XLogP of -0.39, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(2-methoxyethyl)-N'-[(4-methylmorpholin-2-yl)methyl]propane-1,3-diamine is sourced from PubChem (CID 79171784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).