About 1,1-dibenzyl-3-phenylurea
1,1-dibenzyl-3-phenylurea (PubChem CID 791722) has the molecular formula C21H20N2O
and a molecular weight of 316.40 g/mol. Its IUPAC name is 1,1-dibenzyl-3-phenylurea.
Molecular Properties
| Compound Name | 1,1-dibenzyl-3-phenylurea |
| PubChem CID | 791722 |
| Molecular Formula | C21H20N2O |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | 1,1-dibenzyl-3-phenylurea |
| SMILES | O=C(Nc1ccccc1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C21H20N2O/c24-21(22-20-14-8-3-9-15-20)23(16-18-10-4-1-5-11-18)17-19-12-6-2-7-13-19/h1-15H,16-17H2,(H,22,24) |
| InChIKey | PTHTXCJHLYXEMB-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,1-dibenzyl-3-phenylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dibenzyl-3-phenylurea?
The IUPAC name of 1,1-dibenzyl-3-phenylurea (CID 791722) is 1,1-dibenzyl-3-phenylurea.
What is the SMILES notation for 1,1-dibenzyl-3-phenylurea?
The canonical SMILES for 1,1-dibenzyl-3-phenylurea is O=C(Nc1ccccc1)N(Cc1ccccc1)Cc1ccccc1.
What is the InChIKey of 1,1-dibenzyl-3-phenylurea?
The InChIKey is PTHTXCJHLYXEMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20N2O/c24-21(22-20-14-8-3-9-15-20)23(16-18-10-4-1-5-11-18)17-19-12-6-2-7-13-19/h1-15H,16-17H2,(H,22,24).
What are the key properties of 1,1-dibenzyl-3-phenylurea?
1,1-dibenzyl-3-phenylurea has a molecular weight of 316.40 g/mol, XLogP of 4.92, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dibenzyl-3-phenylurea is sourced from PubChem (CID 791722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).