About 3-[1-(2,3-dichloroprop-2-enyl)pyrrolidin-2-yl]propan-1-ol
3-[1-(2,3-dichloroprop-2-enyl)pyrrolidin-2-yl]propan-1-ol (PubChem CID 79172688) has the molecular formula C10H17Cl2NO
and a molecular weight of 238.16 g/mol. Its IUPAC name is 3-[1-(2,3-dichloroprop-2-enyl)pyrrolidin-2-yl]propan-1-ol.
Molecular Properties
| Compound Name | 3-[1-(2,3-dichloroprop-2-enyl)pyrrolidin-2-yl]propan-1-ol |
| PubChem CID | 79172688 |
| Molecular Formula | C10H17Cl2NO |
| Molecular Weight | 238.16 g/mol |
| Exact Mass | 237.07 |
| IUPAC Name | 3-[1-(2,3-dichloroprop-2-enyl)pyrrolidin-2-yl]propan-1-ol |
| SMILES | OCCCC1CCCN1CC(Cl)=CCl |
| InChI | InChI=1S/C10H17Cl2NO/c11-7-9(12)8-13-5-1-3-10(13)4-2-6-14/h7,10,14H,1-6,8H2 |
| InChIKey | QUNXEOHFQQUODW-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.16 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[1-(2,3-dichloroprop-2-enyl)pyrrolidin-2-yl]propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1-(2,3-dichloroprop-2-enyl)pyrrolidin-2-yl]propan-1-ol?
The IUPAC name of 3-[1-(2,3-dichloroprop-2-enyl)pyrrolidin-2-yl]propan-1-ol (CID 79172688) is 3-[1-(2,3-dichloroprop-2-enyl)pyrrolidin-2-yl]propan-1-ol.
What is the SMILES notation for 3-[1-(2,3-dichloroprop-2-enyl)pyrrolidin-2-yl]propan-1-ol?
The canonical SMILES for 3-[1-(2,3-dichloroprop-2-enyl)pyrrolidin-2-yl]propan-1-ol is OCCCC1CCCN1CC(Cl)=CCl.
What is the InChIKey of 3-[1-(2,3-dichloroprop-2-enyl)pyrrolidin-2-yl]propan-1-ol?
The InChIKey is QUNXEOHFQQUODW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17Cl2NO/c11-7-9(12)8-13-5-1-3-10(13)4-2-6-14/h7,10,14H,1-6,8H2.
What are the key properties of 3-[1-(2,3-dichloroprop-2-enyl)pyrrolidin-2-yl]propan-1-ol?
3-[1-(2,3-dichloroprop-2-enyl)pyrrolidin-2-yl]propan-1-ol has a molecular weight of 238.16 g/mol, XLogP of 2.54, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-(2,3-dichloroprop-2-enyl)pyrrolidin-2-yl]propan-1-ol is sourced from PubChem (CID 79172688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).