C16H14BrCl2NO2 — CID 7917269
(2S)-2-(4-bromo-2-chloro-6-methylphenoxy)-N-(3-chlorophenyl)propanamide (PubChem CID 7917269) has the molecular formula C16H14BrCl2NO2 and a molecular weight of 403.10 g/mol. Its IUPAC name is (2S)-2-(4-bromo-2-chloro-6-methylphenoxy)-N-(3-chlorophenyl)propanamide.
| Compound Name | (2S)-2-(4-bromo-2-chloro-6-methylphenoxy)-N-(3-chlorophenyl)propanamide |
|---|---|
| PubChem CID | 7917269 |
| Molecular Formula | C16H14BrCl2NO2 |
| Molecular Weight | 403.10 g/mol |
| Exact Mass | 400.96 |
| IUPAC Name | (2S)-2-(4-bromo-2-chloro-6-methylphenoxy)-N-(3-chlorophenyl)propanamide |
| SMILES | Cc1cc(Br)cc(Cl)c1O[C@@H](C)C(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C16H14BrCl2NO2/c1-9-6-11(17)7-14(19)15(9)22-10(2)16(21)20-13-5-3-4-12(18)8-13/h3-8,10H,1-2H3,(H,20,21)/t10-/m0/s1 |
| InChIKey | IZUUHYHCNNMWIA-JTQLQIEISA-N |
| XLogP | 5.47 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.10 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |