C12H12IN3 — CID 79172818
2-N-(4-iodophenyl)-4-methylpyridine-2,5-diamine (PubChem CID 79172818) has the molecular formula C12H12IN3 and a molecular weight of 325.15 g/mol. Its IUPAC name is 2-N-(4-iodophenyl)-4-methylpyridine-2,5-diamine.
| Compound Name | 2-N-(4-iodophenyl)-4-methylpyridine-2,5-diamine |
|---|---|
| PubChem CID | 79172818 |
| Molecular Formula | C12H12IN3 |
| Molecular Weight | 325.15 g/mol |
| Exact Mass | 325.01 |
| IUPAC Name | 2-N-(4-iodophenyl)-4-methylpyridine-2,5-diamine |
| SMILES | Cc1cc(Nc2ccc(I)cc2)ncc1N |
| InChI | InChI=1S/C12H12IN3/c1-8-6-12(15-7-11(8)14)16-10-4-2-9(13)3-5-10/h2-7H,14H2,1H3,(H,15,16) |
| InChIKey | SJNCNWSTNHWUBG-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.15 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|