C9H15Cl2NO — CID 79173068
4-(2,3-dichloroprop-2-enoxy)cyclohexan-1-amine (PubChem CID 79173068) has the molecular formula C9H15Cl2NO and a molecular weight of 224.13 g/mol. Its IUPAC name is 4-(2,3-dichloroprop-2-enoxy)cyclohexan-1-amine.
| Compound Name | 4-(2,3-dichloroprop-2-enoxy)cyclohexan-1-amine |
|---|---|
| PubChem CID | 79173068 |
| Molecular Formula | C9H15Cl2NO |
| Molecular Weight | 224.13 g/mol |
| Exact Mass | 223.05 |
| IUPAC Name | 4-(2,3-dichloroprop-2-enoxy)cyclohexan-1-amine |
| SMILES | NC1CCC(OCC(Cl)=CCl)CC1 |
| InChI | InChI=1S/C9H15Cl2NO/c10-5-7(11)6-13-9-3-1-8(12)2-4-9/h5,8-9H,1-4,6,12H2 |
| InChIKey | ODGUJTDJCCWRDT-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.13 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |