2-[2,3-dichloroprop-2-enyl(methyl)amino]propanoic acid

C7H11Cl2NO2 — CID 79173374

IUPAC2-[2,3-dichloroprop-2-enyl(methyl)amino]propanoic acid
SMILESCC(C(=O)O)N(C)CC(Cl)=CCl
InChIInChI=1S/C7H11Cl2NO2/c1-5(7(11)12)10(2)4-6(9)3-8/h3,5H,4H2,1-2H3,(H,11,12)
InChIKeyKNPMFNPCYMFRRK-UHFFFAOYSA-N
MW212.08 g/mol
LogP1.71
Rot. Bonds4

About 2-[2,3-dichloroprop-2-enyl(methyl)amino]propanoic acid

2-[2,3-dichloroprop-2-enyl(methyl)amino]propanoic acid (PubChem CID 79173374) has the molecular formula C7H11Cl2NO2 and a molecular weight of 212.08 g/mol. Its IUPAC name is 2-[2,3-dichloroprop-2-enyl(methyl)amino]propanoic acid.

Molecular Properties

Compound Name2-[2,3-dichloroprop-2-enyl(methyl)amino]propanoic acid
PubChem CID79173374
Molecular FormulaC7H11Cl2NO2
Molecular Weight212.08 g/mol
Exact Mass211.02
IUPAC Name2-[2,3-dichloroprop-2-enyl(methyl)amino]propanoic acid
SMILESCC(C(=O)O)N(C)CC(Cl)=CCl
InChIInChI=1S/C7H11Cl2NO2/c1-5(7(11)12)10(2)4-6(9)3-8/h3,5H,4H2,1-2H3,(H,11,12)
InChIKeyKNPMFNPCYMFRRK-UHFFFAOYSA-N
XLogP1.71
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500212.08
LogP ≤ 51.71
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-[2,3-dichloroprop-2-enyl(methyl)amino]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2,3-dichloroprop-2-enyl(methyl)amino]propanoic acid?
The IUPAC name of 2-[2,3-dichloroprop-2-enyl(methyl)amino]propanoic acid (CID 79173374) is 2-[2,3-dichloroprop-2-enyl(methyl)amino]propanoic acid.
What is the SMILES notation for 2-[2,3-dichloroprop-2-enyl(methyl)amino]propanoic acid?
The canonical SMILES for 2-[2,3-dichloroprop-2-enyl(methyl)amino]propanoic acid is CC(C(=O)O)N(C)CC(Cl)=CCl.
What is the InChIKey of 2-[2,3-dichloroprop-2-enyl(methyl)amino]propanoic acid?
The InChIKey is KNPMFNPCYMFRRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11Cl2NO2/c1-5(7(11)12)10(2)4-6(9)3-8/h3,5H,4H2,1-2H3,(H,11,12).
What are the key properties of 2-[2,3-dichloroprop-2-enyl(methyl)amino]propanoic acid?
2-[2,3-dichloroprop-2-enyl(methyl)amino]propanoic acid has a molecular weight of 212.08 g/mol, XLogP of 1.71, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2,3-dichloroprop-2-enyl(methyl)amino]propanoic acid is sourced from PubChem (CID 79173374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).