About [1-(2,3-dichloroprop-2-enyl)piperidin-2-yl]methanol
[1-(2,3-dichloroprop-2-enyl)piperidin-2-yl]methanol (PubChem CID 79173393) has the molecular formula C9H15Cl2NO
and a molecular weight of 224.13 g/mol. Its IUPAC name is [1-(2,3-dichloroprop-2-enyl)piperidin-2-yl]methanol.
Molecular Properties
| Compound Name | [1-(2,3-dichloroprop-2-enyl)piperidin-2-yl]methanol |
| PubChem CID | 79173393 |
| Molecular Formula | C9H15Cl2NO |
| Molecular Weight | 224.13 g/mol |
| Exact Mass | 223.05 |
| IUPAC Name | [1-(2,3-dichloroprop-2-enyl)piperidin-2-yl]methanol |
| SMILES | OCC1CCCCN1CC(Cl)=CCl |
| InChI | InChI=1S/C9H15Cl2NO/c10-5-8(11)6-12-4-2-1-3-9(12)7-13/h5,9,13H,1-4,6-7H2 |
| InChIKey | ZFTQGHTZWGNLIC-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.13 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [1-(2,3-dichloroprop-2-enyl)piperidin-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(2,3-dichloroprop-2-enyl)piperidin-2-yl]methanol?
The IUPAC name of [1-(2,3-dichloroprop-2-enyl)piperidin-2-yl]methanol (CID 79173393) is [1-(2,3-dichloroprop-2-enyl)piperidin-2-yl]methanol.
What is the SMILES notation for [1-(2,3-dichloroprop-2-enyl)piperidin-2-yl]methanol?
The canonical SMILES for [1-(2,3-dichloroprop-2-enyl)piperidin-2-yl]methanol is OCC1CCCCN1CC(Cl)=CCl.
What is the InChIKey of [1-(2,3-dichloroprop-2-enyl)piperidin-2-yl]methanol?
The InChIKey is ZFTQGHTZWGNLIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15Cl2NO/c10-5-8(11)6-12-4-2-1-3-9(12)7-13/h5,9,13H,1-4,6-7H2.
What are the key properties of [1-(2,3-dichloroprop-2-enyl)piperidin-2-yl]methanol?
[1-(2,3-dichloroprop-2-enyl)piperidin-2-yl]methanol has a molecular weight of 224.13 g/mol, XLogP of 2.15, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(2,3-dichloroprop-2-enyl)piperidin-2-yl]methanol is sourced from PubChem (CID 79173393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).